ChemNet > CAS > 108124-17-0 2-Methyl-5-phenylfuran-3-carboxylic acid
108124-17-0 2-Methyl-5-phenylfuran-3-carboxylic acid
Nama produk |
2-Methyl-5-phenylfuran-3-carboxylic acid |
Sinonim |
2-Methyl-5-phenyl-3-furoic acid; 2-methyl-5-phenylfuran-3-carboxylate |
MF |
C12H9O3 |
Berat Molekul |
201.1986 |
InChI |
InChI=1/C12H10O3/c1-8-10(12(13)14)7-11(15-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,13,14)/p-1 |
CAS NO |
108124-17-0 |
Struktur Molekul |
|
Titik lebur |
176-179℃ |
Titik didih |
357.1°C at 760 mmHg |
Titik nyala |
169.8°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|