ChemNet > CAS > 143096-86-0 2,2-Difluoro-1,3-benzodioxole-4-carbonyl chloride
143096-86-0 2,2-Difluoro-1,3-benzodioxole-4-carbonyl chloride
Nama produk |
2,2-Difluoro-1,3-benzodioxole-4-carbonyl chloride |
Sinonim |
methyl tridecafluoroheptanoate; 2,2-difluoro-1,3-benzodioxole-4-carboxylate |
MF |
C8H3F2O4 |
Berat Molekul |
201.1044 |
InChI |
InChI=1/C8H4F2O4/c9-8(10)13-5-3-1-2-4(7(11)12)6(5)14-8/h1-3H,(H,11,12)/p-1 |
CAS NO |
143096-86-0 |
Struktur Molekul |
|
Titik didih |
260.8°C at 760 mmHg |
Titik nyala |
111.5°C |
Simbol bahaya |
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|