ChemNet > CAS > 146132-95-8 3,5,7-Trihydroxy-3',4',5'-trimethoxyflavone
146132-95-8 3,5,7-Trihydroxy-3',4',5'-trimethoxyflavone
Nama produk |
3,5,7-Trihydroxy-3',4',5'-trimethoxyflavone |
Sinonim |
Myricetin trimethyl ether; 3,5,7-trihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one |
MF |
C18H16O8 |
Berat Molekul |
360.3148 |
InChI |
InChI=1/C18H16O8/c1-23-12-4-8(5-13(24-2)18(12)25-3)17-16(22)15(21)14-10(20)6-9(19)7-11(14)26-17/h4-7,19-20,22H,1-3H3 |
CAS NO |
146132-95-8 |
Struktur Molekul |
|
Kepadatan |
1.482g/cm3 |
Titik didih |
585.2°C at 760 mmHg |
Indeks bias |
1.658 |
Titik nyala |
213.9°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|