ChemNet > CAS > 3085-42-5 4-Chlorophenyl sulfoxide
3085-42-5 4-Chlorophenyl sulfoxide
Nama produk |
4-Chlorophenyl sulfoxide |
Sinonim |
Bis(4-chlorophenyl) sulfoxide; 4-Chlorophenyl sulphoxide~4,4-Dichlorodiphenyl sulphoxide; 4,4-Dichlorodiphenyl sulfoxide; 1,1'-sulfinylbis(4-chlorobenzene) |
MF |
C12H8Cl2OS |
Berat Molekul |
271.1623 |
InChI |
InChI=1/C12H8Cl2OS/c13-9-1-5-11(6-2-9)16(15)12-7-3-10(14)4-8-12/h1-8H |
CAS NO |
3085-42-5 |
EINECS |
221-397-9 |
Struktur Molekul |
|
Kepadatan |
1.48g/cm3 |
Titik lebur |
140-145℃ |
Titik didih |
406.2°C at 760 mmHg |
Indeks bias |
1.689 |
Titik nyala |
199.5°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|