ChemNet > CAS > 3147-39-5 Methyl 2,4,6-trihydroxybenzoate
3147-39-5 Methyl 2,4,6-trihydroxybenzoate
Nama produk |
Methyl 2,4,6-trihydroxybenzoate |
Sinonim |
2,4,6-Trihydroxybenzoic acid methyl ester; Phloroglucinolcarboxylic acid methyl ester |
MF |
C8H8O5 |
Berat Molekul |
184.1461 |
InChI |
InChI=1/C8H8O5/c1-13-8(12)7-5(10)2-4(9)3-6(7)11/h2-3,9-11H,1H3 |
CAS NO |
3147-39-5 |
EINECS |
221-566-7 |
Struktur Molekul |
|
Kepadatan |
1.501g/cm3 |
Titik lebur |
174-176℃ |
Titik didih |
359.5°C at 760 mmHg |
Indeks bias |
1.63 |
Titik nyala |
150.3°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|