ChemNet > CAS > 35541-81-2 1,4-cyclohexanedimethanol dibenzoate
35541-81-2 1,4-cyclohexanedimethanol dibenzoate
Nama produk |
1,4-cyclohexanedimethanol dibenzoate |
Sinonim |
1,4-Cyclohexanedimethanol dibenzoate,mixture of cis and trans; cyclohexane-1,4-diyldimethanediyl dibenzoate; cyclohexane-1,4-diylbis(methylene) dibenzoate |
MF |
C22H24O4 |
Berat Molekul |
352.4236 |
InChI |
InChI=1/C22H24O4/c23-21(19-7-3-1-4-8-19)25-15-17-11-13-18(14-12-17)16-26-22(24)20-9-5-2-6-10-20/h1-10,17-18H,11-16H2 |
CAS NO |
35541-81-2 |
Struktur Molekul |
|
Kepadatan |
1.125g/cm3 |
Titik didih |
472.9°C at 760 mmHg |
Indeks bias |
1.549 |
Titik nyala |
233.7°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
|
|