ChemNet > CAS > 437-64-9 4',5-Dihydroxy-7-methoxyflavone
437-64-9 4',5-Dihydroxy-7-methoxyflavone
Nama produk |
4',5-Dihydroxy-7-methoxyflavone |
Sinonim |
Genkwanin; Gengkwanin |
MF |
C16H12O5 |
Berat Molekul |
284.26 |
InChI |
InChI=1/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
CAS NO |
437-64-9 |
Struktur Molekul |
|
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|