ChemNet > CAS > 4567-98-0 dimethyl undecanedioate
4567-98-0 dimethyl undecanedioate
Nama produk |
dimethyl undecanedioate |
Sinonim |
224-943-4; undecanedioic acid, dimethyl ester |
MF |
C13H24O4 |
Berat Molekul |
244.3273 |
InChI |
InChI=1/C13H24O4/c1-16-12(14)10-8-6-4-3-5-7-9-11-13(15)17-2/h3-11H2,1-2H3 |
CAS NO |
4567-98-0 |
EINECS |
224-943-4 |
Struktur Molekul |
|
Kepadatan |
0.976g/cm3 |
Titik lebur |
17-19℃ |
Titik didih |
287.7°C at 760 mmHg |
Indeks bias |
1.439 |
Titik nyala |
129.2°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|