ChemNet > CAS > 5380-42-7 Thiophene-2-carboxylic acid methy lester
5380-42-7 Thiophene-2-carboxylic acid methy lester
Nama produk |
Thiophene-2-carboxylic acid methy lester |
Sinonim |
Thiophene-2-carboxylic acid methyl ester; Methyl thiophene-2-carboxylate |
MF |
C6H6O2S |
Berat Molekul |
142.1756 |
InChI |
InChI=1/C6H6O2S/c1-8-6(7)5-3-2-4-9-5/h2-4H,1H3 |
CAS NO |
5380-42-7 |
EINECS |
226-371-0 |
Struktur Molekul |
|
Kepadatan |
1.217g/cm3 |
Titik didih |
200.2°C at 760 mmHg |
Indeks bias |
1.535 |
Titik nyala |
74.9°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|