ChemNet > CAS > 5751-82-6 Ethyl 5-chlorothiophene-2-carboxylate
5751-82-6 Ethyl 5-chlorothiophene-2-carboxylate
Nama produk |
Ethyl 5-chlorothiophene-2-carboxylate |
Sinonim |
5-Chlorothiophene-2-carboxylic acid ethyl ester; Ethyl 5-chlorothiophene-2-carboxlate;
|
MF |
C7H7ClO2S |
Berat Molekul |
190.6473 |
InChI |
InChI=1/C7H7ClO2S/c1-2-10-7(9)5-3-4-6(8)11-5/h3-4H,2H2,1H3 |
CAS NO |
5751-82-6 |
Struktur Molekul |
|
Kepadatan |
1.312g/cm3 |
Titik didih |
253.7°C at 760 mmHg |
Indeks bias |
1.545 |
Titik nyala |
107.3°C |
Simbol bahaya |
|
Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|