Details for Ortho Chloro Para Nitro Aniline

Ortho Chloro Para Nitro Aniline
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
121-87-9 |
EC NO: |
204-502-2 |
Molecular Formula: |
C6H5ClN2O2 |
Molecular Weight: |
172.5691 |
Specification: |
|
InChI: |
InChI=1/C6H5ClN2O2/c7-6-4(8)2-1-3-5(6)9(10)11/h1-3H,8H2 |
Synonyms: |
2-chloro-4-nitro-anilin;2-chloro-4-nitro-benzenamin;2-Chloro-4-nitrobenzenamine;2-CHLORO-4-NITRO-PHENYLAMINE;4-NITRO-2-CHLOROANILINE;ORTHO CHLORO PARA NITRO ANILINE;ocpn;OCPNA;O-CHLORO-P-NITRO ANILINE;4-CHLORO-2-NITROANILINE, 1000MG, NEAT;2-CHLORO-4-NITROANILINE WET 97%;orthoChloro-p-Nitroaniline;o-chloro-nitroaniline;2-chloro-3-nitroaniline; |
Molecular Structure: |
 |
if you are sourcing Ortho Chloro Para Nitro Aniline from India ,just feel free to inquire