Details for 3-Phenoxybenzyl alcohol

3-Phenoxybenzyl alcohol
| Category: |
Agrochemicals |
|
| CAS NO: |
13826-35-2 |
| EC NO: |
237-525-1 |
| Molecular Formula: |
C13H12O2 |
| Molecular Weight: |
200.2332 |
| Specification: |
|
| InChI: |
InChI=1/C13H12O2/c14-10-11-5-4-8-13(9-11)15-12-6-2-1-3-7-12/h1-9,14H,10H2 |
| Synonyms: |
3-PBA;3-phenoxybenzenemethanol;MPBA;m-Phenoxybenzyl alcohol;M-phenoxy benzyl alcohol;(3-phenoxyphenyl)methanol;3-Phenoxy benzyl alcohole; |
| Molecular Structure: |
 |
if you are sourcing 3-Phenoxybenzyl alcohol from China ,just feel free to inquire