Details for 2-amino-3-methylbenzoic acid

2-amino-3-methylbenzoic acid
| Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
4389-45-1 |
| EC NO: |
224-505-2 |
| Molecular Formula: |
C8H9NO2 |
| Molecular Weight: |
151.1626 |
| Specification: |
|
| InChI: |
InChI=1/C8H9NO2/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4H,9H2,1H3,(H,10,11) |
| Synonyms: |
3-Methylanthranilic acid;3-Methyl-2-Amino Benzoic Acid;2-Amino-3-Methybenzoic Acid;2-Aminobenzoic-3-methyl acid; |
| Molecular Structure: |
 |
if you are sourcing 2-amino-3-methylbenzoic acid from China ,just feel free to inquire