Details for N-Ethyl-o-toluidine

N-Ethyl-o-toluidine
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
94-68-8 |
| EC NO: |
202-354-3 |
| Molecular Formula: |
C9H13N |
| Molecular Weight: |
135.2062 |
| Specification: |
|
| InChI: |
InChI=1/C9H13N/c1-3-10-9-7-5-4-6-8(9)2/h4-7,10H,3H2,1-2H3 |
| Synonyms: |
2-Ethylaminotoluene;N-Ethyl-2-aminotoluene;N-Ethyl-2-toluidine;N-Ethyl-2-methylaniline;Ethylamino-o-methylbenzene;Ethyl-O-toluidine;1-(Ethylamino)-2-methylbenzene; |
| Molecular Structure: |
 |
if you are sourcing N-Ethyl-o-toluidine from China ,just feel free to inquire