Details for Methyl iso butyl ketone

Methyl iso butyl ketone
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
108-10-1 |
| EC NO: |
203-550-1 |
| Molecular Formula: |
C6H12O |
| Molecular Weight: |
100.1589 |
| Specification: |
|
| InChI: |
InChI=1/C6H12O/c1-5(2)4-6(3)7/h5H,4H2,1-3H3 |
| Synonyms: |
Isobutyl methyl ketone;Isopropylacetone;Methyl isobutyl ketone;MIBK;Hexone;Methyl isobutyl keton;Methyl isobuty ketone;4-methylpentan-2-one; |
| Molecular Structure: |
 |
if you are sourcing Methyl iso butyl ketone from India ,just feel free to inquire