Details for Diphenylacetic Acid

Diphenylacetic Acid
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
117-34-0 |
| EC NO: |
204-185-0 |
| Molecular Formula: |
C14H12O2 |
| Molecular Weight: |
212.2439 |
| Specification: |
|
| InChI: |
InChI=1/C14H12O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,15,16) |
| Packing: |
40 Kg fibreboard kegs with polythene inner bag |
| Synonyms: |
Benzeneacetic acid, alpha-phenyl-;2,2-Diphenylacetic Acid; |
| Molecular Structure: |
 |
if you are sourcing Diphenylacetic Acid from Italy ,just feel free to inquire