Details for 2-Ethylbutanal

2-Ethylbutanal
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
97-96-1 |
| EC NO: |
202-623-5 |
| Molecular Formula: |
C6H12O |
| Molecular Weight: |
100.1589 |
| Specification: |
|
| InChI: |
InChI=1/C6H12O/c1-3-6(4-2)5-7/h5-6H,3-4H2,1-2H3 |
| Synonyms: |
Butanal, 2-ethyl-;2-Ethylbutyraldehyde;2-Ethylbutyric aldehyde;2-Ethylbutyric aledhyde;3-Formylpentane;4-01-00-03310 (Beilstein Handbook Reference);Aldehyde 2-ethylbutyrique;Aldehyde 2-ethylbutyrique [French];BRN 1209330;Butyraldehyde, 2-ethyl-;Diethyl acetaldehyde;Diethylacetaldehyde;Ethyl butyraldehyde;FEMA No. 2426;NSC 6757;alpha-Ethylbutanal;alpha-Ethylbutyraldehyde;2-Ethylbutyraldehyde [UN1178] [Flammable liquid];UN1178; |
| Molecular Structure: |
 |
if you are sourcing 2-Ethylbutanal from Japan ,just feel free to inquire