Details for Dimethyl Lauryl/myristyl Amine

Dimethyl Lauryl/myristyl Amine
| Category: |
Organic chemicals and Derivatives/Basic organic raw materials |
|
| CAS NO: |
112-75-4 |
| EC NO: |
204-002-4 |
| Molecular Formula: |
C16H35N |
| Molecular Weight: |
241.4558 |
| Specification: |
|
| InChI: |
InChI=1/C16H35N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)3/h4-16H2,1-3H3 |
| Synonyms: |
N,N-Dimethyl-n-tetradecylamine;Tetradecyl dimethyl amine;N,N-dimethyltetradecan-1-amine;Dimethyl Myristyl Amine;DMA1497;1-(Dimethylamino)Tetradecane;Dimethyl Lauryl-Myristyl Amine;
|
| Molecular Structure: |
 |
if you are sourcing Dimethyl Lauryl/myristyl Amine from China ,just feel free to inquire