| Category: |
Inorganic chemicals |
|
| CAS NO: |
584-08-7 |
| EC NO: |
209-529-3 |
| Molecular Formula: |
K2CO3 |
| Molecular Weight: |
138.2066 |
| Specification: |
|
| InChI: |
InChI=1/CH2O3.2K.2H/c2-1(3)4;;;;/h(H2,2,3,4);;;;/p-2/rCH2O3.2HK/c2-1(3)4;;/h(H2,2,3,4);2*1H/p-2 |
Product description:
White granules or granular, translucent powder, small glassy colorless crystals, colorless monoclinic crystals. Hygroscopic. |
| Synonyms: |
Potassium carbonate anhydrous;Potassium carbonate hemihydrate;Potassiumcarbonate;Dipotassium carbonate;Carbonic acid, dipotassium salt;Carbonate Of Potash;Salt of tartar;alt of wormwood;Pearl ash;Potassium carbonate,anhydrous;Heavy potassium carbonate; |
| Molecular Structure: |
 |