| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
140-88-5 |
| EC NO: |
205-438-8 |
| Molecular Formula: |
C5H8O2 |
| Molecular Weight: |
100.12 |
| Specification: |
|
| InChI: |
InChI=1/C5H8O2/c1-3-4(2)5(6)7/h2-3H2,1H3,(H,6,7)/p-1 |
| Packing: |
180KG/DRUM OR 20MT/ISO-TANK |
Product description:
classification | intermediate organic material | CAS No. | 140-88-5 | Other Names | EA | MF | C5H8O2 | Place of Origin Packing | Shanghai, China (Mainland) 180Kg/Plastic Drum | Grade Standard | Industrial Grade | Assay | 99.5% MIN | Appearance | Colorless Transparent liquid | Application | Coating & textile adhesive | Brand Name | Yaxing, Satellite | Model Number | Industrial grade |
|
| Synonyms: |
Acrylic acid ethyl ester;EA;ethyl prop-2-enoate;2-methylidenebutanoate;2-Propenoic Acid Ethyl Ester; |
| Molecular Structure: |
 |