Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
87-72-9 |
EC NO: |
201-767-6 |
Molecular Formula: |
C5H10O5 |
Molecular Weight: |
150.1299 |
Specification: |
|
InChI: |
InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5?/m0/s1 |
Product description:
Eyes: Wear appropriate protective eyeglasses or chemical safety goggles as described by OSHA's eye and face protection regulations in 29 CFR 1910.133 or European Standard EN166. Skin: Wear appropriate protective gloves and clothing to prevent skin exposure. Clothing: Wear appropriate protective clothing to minimize contact with skin.
|
Synonyms: |
L-(+)-Arabinose;L(+)arabinose;alpha-L-arabinopyranose;N-{[4'-({3-butyl-5-oxo-1-[2-(trifluoromethyl)phenyl]-1,5-dihydro-4H-1,2,4-triazol-4-yl}methyl)biphenyl-2-yl]sulfonyl}-5-methylthiophene-2-carboxamide; |
Molecular Structure: |
 |