ChemNet > CAS > 101-99-5 N-Phenylurethane
101-99-5 N-Phenylurethane
název výrobku |
N-Phenylurethane |
Synonyma |
Ethyl carbanilate~Ethyl N-phenylcarbamate; ethyl phenylcarbamate |
Molekulární vzorec |
C9H11NO2 |
Molekulová hmotnost |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
Registrační číslo CAS |
101-99-5 |
EINECS |
202-995-9 |
Molekulární struktura |
|
Hustota |
1.136g/cm3 |
Bod varu |
238°C at 760 mmHg |
Index lomu |
1.558 |
Bod vzplanutí |
79.2°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R40:Possible risks of irreversible effects.;
|
Bezpečnostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|