ChemNet > CAS > 105-05-5 1,4-Diethylbenzene
105-05-5 1,4-Diethylbenzene
| název výrobku |
1,4-Diethylbenzene |
| Synonyma |
Benzene, 1,4-diethyl-; Benzene, p-diethyl-; HSDB 4083; p-Diethylbenzene; p-Ethylethylbenzene; butan-2-ylbenzene; PDEB |
| Molekulární vzorec |
C10H14 |
| Molekulová hmotnost |
134.2182 |
| InChI |
InChI=1/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
| Registrační číslo CAS |
105-05-5 |
| EINECS |
203-265-2 |
| Molekulární struktura |
|
| Hustota |
0.86g/cm3 |
| Bod tání |
-43℃ |
| Bod varu |
173.3°C at 760 mmHg |
| Index lomu |
1.489 |
| Bod vzplanutí |
46.3°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
|
| Bezpečnostní Popis |
S24/25:Avoid contact with skin and eyes.;
|
|
