ChemNet > CAS > 1194-66-7 2,6-Dichloronitrosobenzene
1194-66-7 2,6-Dichloronitrosobenzene
| název výrobku |
2,6-Dichloronitrosobenzene |
| Synonyma |
1,3-dichloro-2-nitrosobenzene |
| Molekulární vzorec |
C6H3Cl2NO |
| Molekulová hmotnost |
176.0001 |
| InChI |
InChI=1/C6H3Cl2NO/c7-4-2-1-3-5(8)6(4)9-10/h1-3H |
| Registrační číslo CAS |
1194-66-7 |
| Molekulární struktura |
|
| Hustota |
1.45g/cm3 |
| Bod varu |
271.9°C at 760 mmHg |
| Index lomu |
1.588 |
| Bod vzplanutí |
120.5°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
