ChemNet > CAS > 145349-76-4 4-(Ethylthio)benzeneboronic acid
145349-76-4 4-(Ethylthio)benzeneboronic acid
| název výrobku |
4-(Ethylthio)benzeneboronic acid |
| Synonyma |
4-(Ethylthio)phenylboronic acid; [4-(ethylsulfanyl)phenyl]boronic acid; 4-Ethylthiophenylboronic acid |
| Molekulární vzorec |
C8H11BO2S |
| Molekulová hmotnost |
182.0477 |
| InChI |
InChI=1/C8H11BO2S/c1-2-12-8-5-3-7(4-6-8)9(10)11/h3-6,10-11H,2H2,1H3 |
| Registrační číslo CAS |
145349-76-4 |
| Molekulární struktura |
|
| Hustota |
1.18g/cm3 |
| Bod varu |
343.5°C at 760 mmHg |
| Index lomu |
1.571 |
| Bod vzplanutí |
161.6°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
