ChemNet > CAS > 150-61-8 1,2-Dianilinoethane
150-61-8 1,2-Dianilinoethane
název výrobku |
1,2-Dianilinoethane |
Synonyma |
N,N-Diphenylethylenediamine; Wanzlicks; 1,2-Dianilinoethane, Pract.; N,N-ethylenedianiline; NN-Diphenylethylenediamine; 1,2-Diphenyl Ethanediamine; N,N'-diphenylethane-1,2-diamine; N,N'-diphenylethane-1,2-diaminium |
Molekulární vzorec |
C14H16N2 |
Molekulová hmotnost |
212.2902 |
InChI |
InChI=1/C14H16N2/c15-11-12-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,15H2 |
Registrační číslo CAS |
150-61-8 |
EINECS |
205-765-6 |
Molekulární struktura |
|
Hustota |
1.093g/cm3 |
Bod tání |
64-67℃ |
Bod varu |
351.529°C at 760 mmHg |
Index lomu |
1.623 |
Bod vzplanutí |
148.617°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
|
Bezpečnostní Popis |
S24/25:Avoid contact with skin and eyes.;
|
|