ChemNet > CAS > 1539-04-4 Diphenyl tere-phthalate
1539-04-4 Diphenyl tere-phthalate
název výrobku |
Diphenyl tere-phthalate |
Synonyma |
Diphenyl terephthalate; Terephthalic acid diphenyl ester; diphenyl benzene-1,4-dicarboxylate |
Molekulární vzorec |
C20H14O4 |
Molekulová hmotnost |
318.3228 |
InChI |
InChI=1/C20H14O4/c21-19(23-17-7-3-1-4-8-17)15-11-13-16(14-12-15)20(22)24-18-9-5-2-6-10-18/h1-14H |
Registrační číslo CAS |
1539-04-4 |
EINECS |
216-264-7 |
Molekulární struktura |
|
Hustota |
1.242g/cm3 |
Bod tání |
197-199℃ |
Bod varu |
496.6°C at 760 mmHg |
Index lomu |
1.615 |
Bod vzplanutí |
255°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
|
Bezpečnostní Popis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|