ChemNet > CAS > 16689-02-4 5-Nitrothiophene-2-carbonitrile
16689-02-4 5-Nitrothiophene-2-carbonitrile
| název výrobku |
5-Nitrothiophene-2-carbonitrile |
| Synonyma |
2-Cyano-5-nitrothiophene |
| Molekulární vzorec |
C5H2N2O2S |
| Molekulová hmotnost |
154.1466 |
| InChI |
InChI=1/C5H2N2O2S/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| Registrační číslo CAS |
16689-02-4 |
| Molekulární struktura |
|
| Hustota |
1.5g/cm3 |
| Bod varu |
273.9°C at 760 mmHg |
| Index lomu |
1.611 |
| Bod vzplanutí |
119.4°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpečnostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
