ChemNet > CAS > 17249-79-5;17249-29-5 2,3-Dichlorothiophene
17249-79-5;17249-29-5 2,3-Dichlorothiophene
název výrobku |
2,3-Dichlorothiophene |
Synonyma |
2,3-dichloro-thiophene |
Molekulární vzorec |
C4H2Cl2S |
Molekulová hmotnost |
153.0297 |
InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
Registrační číslo CAS |
17249-79-5;17249-29-5 |
Molekulární struktura |
|
Hustota |
1.488g/cm3 |
Bod tání |
-26℃ |
Bod varu |
170.7°C at 760 mmHg |
Index lomu |
1.584 |
Bod vzplanutí |
68.9°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpečnostní Popis |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|