ChemNet > CAS > 175135-96-3 ethyl 3-(2-chloro-3,4-dimethoxyphenyl)acrylate
175135-96-3 ethyl 3-(2-chloro-3,4-dimethoxyphenyl)acrylate
| název výrobku |
ethyl 3-(2-chloro-3,4-dimethoxyphenyl)acrylate |
| Synonyma |
ethyl (2E)-3-(2-chloro-3,4-dimethoxyphenyl)prop-2-enoate |
| Molekulární vzorec |
C13H15ClO4 |
| Molekulová hmotnost |
270.7088 |
| InChI |
InChI=1/C13H15ClO4/c1-4-18-11(15)8-6-9-5-7-10(16-2)13(17-3)12(9)14/h5-8H,4H2,1-3H3/b8-6+ |
| Registrační číslo CAS |
175135-96-3 |
| Molekulární struktura |
|
| Hustota |
1.193g/cm3 |
| Bod tání |
68℃ |
| Bod varu |
382.4°C at 760 mmHg |
| Index lomu |
1.542 |
| Bod vzplanutí |
151.5°C |
| Symbolů nebezpečnosti |
 Xi:Irritant;
|
| Riziko Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
