ChemNet > CAS > 175277-93-7 2-Amino-6-fluorobenzylamine
175277-93-7 2-Amino-6-fluorobenzylamine
název výrobku |
2-Amino-6-fluorobenzylamine |
Synonyma |
2-(Aminomethyl)-3-fluoroaniline |
Molekulární vzorec |
C7H9FN2 |
Molekulová hmotnost |
140.1582 |
InChI |
InChI=1/C7H9FN2/c8-6-2-1-3-7(10)5(6)4-9/h1-3H,4,9-10H2 |
Registrační číslo CAS |
175277-93-7 |
Molekulární struktura |
|
Hustota |
1.209g/cm3 |
Bod varu |
265°C at 760 mmHg |
Index lomu |
1.586 |
Bod vzplanutí |
117.4°C |
Symbolů nebezpečnosti |
C:Corrosive;
|
Riziko Codes |
R34:Causes burns.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|