ChemNet > CAS > 19788-49-9 Mercaptopropionicacidethylester
19788-49-9 Mercaptopropionicacidethylester
název výrobku |
Mercaptopropionicacidethylester |
Synonyma |
2-Mercaptopropionic acid ethyl ester; Ethyl thiolactate~2-Mercaptopropionic acid ethyl ester; ethyl 2-sulfanylpropanoate; Ethyl 2-mercaptopropionate |
Molekulární vzorec |
C5H10O2S |
Molekulová hmotnost |
134.1967 |
InChI |
InChI=1/C5H10O2S/c1-3-7-5(6)4(2)8/h4,8H,3H2,1-2H3 |
Registrační číslo CAS |
19788-49-9 |
EINECS |
243-314-5 |
Molekulární struktura |
|
Hustota |
1.04g/cm3 |
Bod varu |
171.7°C at 760 mmHg |
Index lomu |
1.452 |
Bod vzplanutí |
57.4°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpečnostní Popis |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|