ChemNet > CAS > 2024-83-1 3,4-Dimethoxybenzonitrile
2024-83-1 3,4-Dimethoxybenzonitrile
název výrobku |
3,4-Dimethoxybenzonitrile |
Synonyma |
Veratronitrile; 3,4-Dimethoybenzonitrile |
Molekulární vzorec |
C9H9NO2 |
Molekulová hmotnost |
163.1733 |
InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,1-2H3 |
Registrační číslo CAS |
2024-83-1 |
EINECS |
217-969-2 |
Molekulární struktura |
|
Hustota |
1.12g/cm3 |
Bod tání |
66-71℃ |
Bod varu |
266.2°C at 760 mmHg |
Index lomu |
1.519 |
Bod vzplanutí |
107.5°C |
Symbolů nebezpečnosti |
Xn:Harmful;
|
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpečnostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
|
|