ChemNet > CAS > 2113-58-8 3-Nitrobiphenyl
2113-58-8 3-Nitrobiphenyl
název výrobku |
3-Nitrobiphenyl |
Synonyma |
3-Nitrodiphenyl |
Molekulární vzorec |
C12H9NO2 |
Molekulová hmotnost |
199.2054 |
InChI |
InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
Registrační číslo CAS |
2113-58-8 |
EINECS |
218-305-4 |
Molekulární struktura |
|
Hustota |
1.196g/cm3 |
Bod tání |
56-60℃ |
Bod varu |
339°C at 760 mmHg |
Index lomu |
1.605 |
Bod vzplanutí |
161.4°C |
Symbolů nebezpečnosti |
Xn:Harmful;
|
Riziko Codes |
R40:Possible risks of irreversible effects.;
|
Bezpečnostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|