ChemNet > CAS > 2393-97-7 Bis-(4-chlorophenylthio)methane
2393-97-7 Bis-(4-chlorophenylthio)methane
název výrobku |
Bis-(4-chlorophenylthio)methane |
Synonyma |
Bis(4-chlorophenylthio)methane; 1,1'-(methanediyldisulfanediyl)bis(4-chlorobenzene) |
Molekulární vzorec |
C13H10Cl2S2 |
Molekulová hmotnost |
301.2545 |
InChI |
InChI=1/C13H10Cl2S2/c14-10-1-5-12(6-2-10)16-9-17-13-7-3-11(15)4-8-13/h1-8H,9H2 |
Registrační číslo CAS |
2393-97-7 |
Molekulární struktura |
|
Hustota |
1.38g/cm3 |
Bod tání |
45-48℃ |
Bod varu |
420.9°C at 760 mmHg |
Index lomu |
1.677 |
Bod vzplanutí |
192.5°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
|
Bezpečnostní Popis |
S24/25:Avoid contact with skin and eyes.;
|
|