ChemNet > CAS > 2444-68-0 9-Vinylanthracene
2444-68-0 9-Vinylanthracene
| název výrobku |
9-Vinylanthracene |
| Synonyma |
9-Ethenylanthracen; Anthracene, 9-ethenyl- (9CI); 9-ethenylanthracene |
| Molekulární vzorec |
C16H12 |
| Molekulová hmotnost |
204.2665 |
| InChI |
InChI=1/C16H12/c1-2-14-15-9-5-3-7-12(15)11-13-8-4-6-10-16(13)14/h2-11H,1H2 |
| Registrační číslo CAS |
2444-68-0 |
| EINECS |
219-486-2 |
| Molekulární struktura |
|
| Hustota |
1.112g/cm3 |
| Bod tání |
64-66℃ |
| Bod varu |
377°C at 760 mmHg |
| Index lomu |
1.724 |
| Bod vzplanutí |
172.4°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
|
| Bezpečnostní Popis |
S24/25:Avoid contact with skin and eyes.;
|
|
