ChemNet > CAS > 261951-67-1 3-Fluoro-4-methylbenzylamine
261951-67-1 3-Fluoro-4-methylbenzylamine
název výrobku |
3-Fluoro-4-methylbenzylamine |
Synonyma |
1-(3-fluoro-4-methylphenyl)methanamine |
Molekulární vzorec |
C8H10FN |
Molekulová hmotnost |
139.1701 |
InChI |
InChI=1/C8H10FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,5,10H2,1H3 |
Registrační číslo CAS |
261951-67-1 |
Molekulární struktura |
|
Hustota |
1.071g/cm3 |
Bod varu |
198°C at 760 mmHg |
Index lomu |
1.52 |
Bod vzplanutí |
82.4°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R34:Causes burns.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|