ChemNet > CAS > 2693-46-1 3-Aminofluoranthene
2693-46-1 3-Aminofluoranthene
| název výrobku |
3-Aminofluoranthene |
| Synonyma |
3-Fluoranthenamine; fluoranthen-3-ylamine; fluoranthen-3-amine |
| Molekulární vzorec |
C16H11N |
| Molekulová hmotnost |
217.2652 |
| InChI |
InChI=1/C16H11N/c17-15-9-8-13-11-5-2-1-4-10(11)12-6-3-7-14(15)16(12)13/h1-9H,17H2 |
| Registrační číslo CAS |
2693-46-1 |
| EINECS |
220-263-7 |
| Molekulární struktura |
|
| Hustota |
1.322g/cm3 |
| Bod tání |
115-117℃ |
| Bod varu |
440.8°C at 760 mmHg |
| Index lomu |
1.904 |
| Bod vzplanutí |
246.2°C |
| Symbolů nebezpečnosti |
 Xn:Harmful;
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpečnostní Popis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
