ChemNet > CAS > 30273-00-8 2,4-Dichloro-6-methylaniline
30273-00-8 2,4-Dichloro-6-methylaniline
| název výrobku |
2,4-Dichloro-6-methylaniline |
| Synonyma |
4,6-Dichloro-o-toluidine |
| Molekulární vzorec |
C7H7Cl2N |
| Molekulová hmotnost |
176.0432 |
| InChI |
InChI=1/C7H7Cl2N/c1-4-2-5(8)3-6(9)7(4)10/h2-3H,10H2,1H3 |
| Registrační číslo CAS |
30273-00-8 |
| Molekulární struktura |
|
| Hustota |
1.334g/cm3 |
| Bod tání |
43-45℃ |
| Bod varu |
263.8°C at 760 mmHg |
| Index lomu |
1.599 |
| Bod vzplanutí |
113.4°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R52:Harmful to aquatic organisms.;
|
| Bezpečnostní Popis |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
