ChemNet > CAS > 3088-42-4 N-(2-Cyanoethyl)glycine
3088-42-4 N-(2-Cyanoethyl)glycine
| název výrobku |
N-(2-Cyanoethyl)glycine |
| Synonyma |
N-(2-Cyanoehtyl)glycine |
| Molekulární vzorec |
C5H8N2O2 |
| Molekulová hmotnost |
128.1292 |
| InChI |
InChI=1/C5H8N2O2/c6-2-1-3-7-4-5(8)9/h7H,1,3-4H2,(H,8,9) |
| Registrační číslo CAS |
3088-42-4 |
| EINECS |
221-418-1 |
| Molekulární struktura |
|
| Hustota |
1.187g/cm3 |
| Bod tání |
188-193℃ |
| Bod varu |
343.1°C at 760 mmHg |
| Index lomu |
1.473 |
| Bod vzplanutí |
161.3°C |
| Symbolů nebezpečnosti |
 Xn:Harmful;
|
| Riziko Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Bezpečnostní Popis |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
