ChemNet > CAS > 34688-70-5 Pentamethylphenylacetonitrile
34688-70-5 Pentamethylphenylacetonitrile
název výrobku |
Pentamethylphenylacetonitrile |
Synonyma |
2,3,4,5,6-Pentamethylbenzyl cyanide |
Molekulární vzorec |
C13H17N |
Molekulová hmotnost |
187.2808 |
InChI |
InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
Registrační číslo CAS |
34688-70-5 |
Molekulární struktura |
|
Hustota |
0.95g/cm3 |
Bod tání |
105-107℃ |
Bod varu |
325.9°C at 760 mmHg |
Index lomu |
1.519 |
Bod vzplanutí |
160.2°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R20/22:Harmful by inhalation and if swallowed.;
|
Bezpečnostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|