ChemNet > CAS > 37798-08-6 1-Benzofuran-5-ylmethylamine
37798-08-6 1-Benzofuran-5-ylmethylamine
název výrobku |
1-Benzofuran-5-ylmethylamine |
Synonyma |
1-(1-benzofuran-5-yl)methanamine |
Molekulární vzorec |
C9H9NO |
Molekulová hmotnost |
147.1739 |
InChI |
InChI=1/C9H9NO/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5H,6,10H2 |
Registrační číslo CAS |
37798-08-6 |
Molekulární struktura |
|
Hustota |
1.164g/cm3 |
Bod varu |
254.3°C at 760 mmHg |
Index lomu |
1.628 |
Bod vzplanutí |
107.6°C |
Symbolů nebezpečnosti |
C:Corrosive;
|
Riziko Codes |
R34:Causes burns.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|