ChemNet > CAS > 39565-00-9 2-Acetyl-5-nitrothiophene
39565-00-9 2-Acetyl-5-nitrothiophene
název výrobku |
2-Acetyl-5-nitrothiophene |
Synonyma |
5-Nitro-2-thienyl methyl ketone; Methyl 5-nitro-2-thienyl ketone; 1-(5-nitrothiophen-2-yl)ethanone |
Molekulární vzorec |
C6H5NO3S |
Molekulová hmotnost |
171.1738 |
InChI |
InChI=1/C6H5NO3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3H,1H3 |
Registrační číslo CAS |
39565-00-9 |
Molekulární struktura |
|
Hustota |
1.399g/cm3 |
Bod varu |
268.9°C at 760 mmHg |
Index lomu |
1.589 |
Bod vzplanutí |
116.4°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpečnostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|