ChemNet > CAS > 4104-75-0 N-methyl-N-phenylthiourea
4104-75-0 N-methyl-N-phenylthiourea
| název výrobku |
N-methyl-N-phenylthiourea |
| Synonyma |
1-Methyl-1-phenylthiourea |
| Molekulární vzorec |
C8H10N2S |
| Molekulová hmotnost |
166.2434 |
| InChI |
InChI=1/C8H10N2S/c1-10(8(9)11)7-5-3-2-4-6-7/h2-6H,1H3,(H2,9,11) |
| Registrační číslo CAS |
4104-75-0 |
| EINECS |
223-877-3 |
| Molekulární struktura |
|
| Hustota |
1.221g/cm3 |
| Bod tání |
101℃ |
| Bod varu |
267.1°C at 760 mmHg |
| Index lomu |
1.679 |
| Bod vzplanutí |
115.3°C |
| Symbolů nebezpečnosti |
 Xn:Harmful;
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpečnostní Popis |
S37/39:Wear suitable gloves and eye/face protection.;
|
|
