ChemNet > CAS > 4395-87-3 4-Isopropylphenylacetonitrile
4395-87-3 4-Isopropylphenylacetonitrile
| název výrobku |
4-Isopropylphenylacetonitrile |
| Synonyma |
[4-(propan-2-yl)phenyl]acetonitrile |
| Molekulární vzorec |
C11H13N |
| Molekulová hmotnost |
159.2276 |
| InChI |
InChI=1/C11H13N/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3-6,9H,7H2,1-2H3 |
| Registrační číslo CAS |
4395-87-3 |
| Molekulární struktura |
|
| Hustota |
0.96g/cm3 |
| Bod varu |
261.1°C at 760 mmHg |
| Index lomu |
1.514 |
| Bod vzplanutí |
117.5°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpečnostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
|
|
