ChemNet > CAS > 4553-07-5 Ethyl phenylcyanoacetate
4553-07-5 Ethyl phenylcyanoacetate
| název výrobku |
Ethyl phenylcyanoacetate |
| Synonyma |
Phenylcyanoacetic acid ethyl ester; ethyl cyano(phenyl)acetate; ethyl (2R)-cyano(phenyl)ethanoate; ethyl (2S)-cyano(phenyl)ethanoate; ethyl 2-cyano-2-phenylacetate |
| Molekulární vzorec |
C11H11NO2 |
| Molekulová hmotnost |
189.2105 |
| InChI |
InChI=1/C11H11NO2/c1-2-14-11(13)10(8-12)9-6-4-3-5-7-9/h3-7,10H,2H2,1H3/t10-/m1/s1 |
| Registrační číslo CAS |
4553-07-5 |
| EINECS |
224-921-4 |
| Molekulární struktura |
|
| Hustota |
1.117g/cm3 |
| Bod varu |
275°C at 760 mmHg |
| Index lomu |
1.518 |
| Bod vzplanutí |
137.5°C |
| Symbolů nebezpečnosti |
 Xn:Harmful;
|
| Riziko Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Bezpečnostní Popis |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
