ChemNet > CAS > 55406-13-8 3-Methylthiophene-2-carbonitrile
55406-13-8 3-Methylthiophene-2-carbonitrile
| název výrobku |
3-Methylthiophene-2-carbonitrile |
| Synonyma |
2-Cyano-3-methylthiophene |
| Molekulární vzorec |
C6H5NS |
| Molekulová hmotnost |
123.1756 |
| InChI |
InChI=1/C6H5NS/c1-5-2-3-8-6(5)4-7/h2-3H,1H3 |
| Registrační číslo CAS |
55406-13-8 |
| Molekulární struktura |
|
| Hustota |
1.16g/cm3 |
| Bod varu |
212.7°C at 760 mmHg |
| Index lomu |
1.556 |
| Bod vzplanutí |
82.4°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpečnostní Popis |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
