ChemNet > CAS > 587-02-0 3-Ethylaniline
587-02-0 3-Ethylaniline
| název výrobku |
3-Ethylaniline |
| Synonyma |
3-Ethylbenzenamine; 3-Ethylphenylamine; 4-12-00-02417 (Beilstein Handbook Reference); BRN 0636282; m-Ethylaniline; Aniline, m-ethyl-; Benzenamine, 3-ethyl- (9CI) |
| Molekulární vzorec |
C8H11N |
| Molekulová hmotnost |
121.1796 |
| InChI |
InChI=1/C8H11N/c1-2-7-4-3-5-8(9)6-7/h3-6H,2,9H2,1H3 |
| Registrační číslo CAS |
587-02-0 |
| EINECS |
209-594-8 |
| Molekulární struktura |
|
| Hustota |
0.973g/cm3 |
| Bod tání |
-8℃ |
| Bod varu |
216.6°C at 760 mmHg |
| Index lomu |
1.556 |
| Bod vzplanutí |
85°C |
| Symbolů nebezpečnosti |
 T:Toxic;
|
| Riziko Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Bezpečnostní Popis |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
