ChemNet > CAS > 59-82-5 5-Nitro-2-furonitrile
59-82-5 5-Nitro-2-furonitrile
název výrobku |
5-Nitro-2-furonitrile |
Synonyma |
5-Nitro-2-furancarbonitrile; 5-nitrofuran-2-carbonitrile |
Molekulární vzorec |
C5H2N2O3 |
Molekulová hmotnost |
138.081 |
InChI |
InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
Registrační číslo CAS |
59-82-5 |
Molekulární struktura |
|
Hustota |
1.46g/cm3 |
Bod varu |
234.7°C at 760 mmHg |
Index lomu |
1.544 |
Bod vzplanutí |
95.7°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpečnostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|