ChemNet > CAS > 64910-46-9 3-amino-4-(methylamino)benzonitrile
64910-46-9 3-amino-4-(methylamino)benzonitrile
název výrobku |
3-amino-4-(methylamino)benzonitrile |
Molekulární vzorec |
C8H9N3 |
Molekulová hmotnost |
147.1772 |
InChI |
InChI=1/C8H9N3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4,11H,10H2,1H3 |
Registrační číslo CAS |
64910-46-9 |
Molekulární struktura |
|
Hustota |
1.155g/cm3 |
Bod tání |
136℃ |
Bod varu |
346.783°C at 760 mmHg |
Index lomu |
1.593 |
Bod vzplanutí |
163.529°C |
Symbolů nebezpečnosti |
Xn:Harmful;
|
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpečnostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
|
|